C16H15F4N3S — CID 133338786
2,3,5,6-tetrafluoro-N-[(4-thiomorpholin-4-ylphenyl)methyl]pyridin-4-amine (PubChem CID 133338786) has the molecular formula C16H15F4N3S and a molecular weight of 357.38 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(4-thiomorpholin-4-ylphenyl)methyl]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(4-thiomorpholin-4-ylphenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133338786 |
| Molecular Formula | C16H15F4N3S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(4-thiomorpholin-4-ylphenyl)methyl]pyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(NCc2ccc(N3CCSCC3)cc2)c1F |
| InChI | InChI=1S/C16H15F4N3S/c17-12-14(13(18)16(20)22-15(12)19)21-9-10-1-3-11(4-2-10)23-5-7-24-8-6-23/h1-4H,5-9H2,(H,21,22) |
| InChIKey | KPVZJPIJXARMTJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|