C14H11F4N3O2 — CID 133371339
methyl N-[4-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenyl]carbamate (PubChem CID 133371339) has the molecular formula C14H11F4N3O2 and a molecular weight of 329.25 g/mol. Its IUPAC name is methyl N-[4-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 133371339 |
| Molecular Formula | C14H11F4N3O2 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | methyl N-[4-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(CNc2c(F)c(F)nc(F)c2F)cc1 |
| InChI | InChI=1S/C14H11F4N3O2/c1-23-14(22)20-8-4-2-7(3-5-8)6-19-11-9(15)12(17)21-13(18)10(11)16/h2-5H,6H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | NSOMFAPXNUUPQY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|