C13H9F4N3O2 — CID 133371506
methyl N-[4-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]phenyl]carbamate (PubChem CID 133371506) has the molecular formula C13H9F4N3O2 and a molecular weight of 315.23 g/mol. Its IUPAC name is methyl N-[4-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]phenyl]carbamate.
| Compound Name | methyl N-[4-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 133371506 |
| Molecular Formula | C13H9F4N3O2 |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | methyl N-[4-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(Nc2c(F)c(F)nc(F)c2F)cc1 |
| InChI | InChI=1S/C13H9F4N3O2/c1-22-13(21)19-7-4-2-6(3-5-7)18-10-8(14)11(16)20-12(17)9(10)15/h2-5H,1H3,(H,18,20)(H,19,21) |
| InChIKey | UPDAWFFSPHFARO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|