C16H16F4N4O — CID 133338770
2,3,5,6-tetrafluoro-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyridin-4-amine (PubChem CID 133338770) has the molecular formula C16H16F4N4O and a molecular weight of 356.32 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133338770 |
| Molecular Formula | C16H16F4N4O |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyridin-4-amine |
| SMILES | CC1CN(c2ccc(CNc3c(F)c(F)nc(F)c3F)cn2)CCO1 |
| InChI | InChI=1S/C16H16F4N4O/c1-9-8-24(4-5-25-9)11-3-2-10(6-21-11)7-22-14-12(17)15(19)23-16(20)13(14)18/h2-3,6,9H,4-5,7-8H2,1H3,(H,22,23) |
| InChIKey | HDVDMASVFNOPTQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|