C18H31N3OS — CID 75382775
1-tert-butylsulfanyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]propan-2-amine (PubChem CID 75382775) has the molecular formula C18H31N3OS and a molecular weight of 337.53 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]propan-2-amine.
| Compound Name | 1-tert-butylsulfanyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 75382775 |
| Molecular Formula | C18H31N3OS |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 1-tert-butylsulfanyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]propan-2-amine |
| SMILES | CC(CSC(C)(C)C)NCc1ccc(N2CCOC(C)C2)nc1 |
| InChI | InChI=1S/C18H31N3OS/c1-14(13-23-18(3,4)5)19-10-16-6-7-17(20-11-16)21-8-9-22-15(2)12-21/h6-7,11,14-15,19H,8-10,12-13H2,1-5H3 |
| InChIKey | HOVXGIMWSKJDDR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |