C18H32N4S — CID 75382615
1-tert-butylsulfanyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]propan-2-amine (PubChem CID 75382615) has the molecular formula C18H32N4S and a molecular weight of 336.55 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]propan-2-amine.
| Compound Name | 1-tert-butylsulfanyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 75382615 |
| Molecular Formula | C18H32N4S |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 1-tert-butylsulfanyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]propan-2-amine |
| SMILES | CC(CSC(C)(C)C)NCc1ccc(N2CCN(C)CC2)nc1 |
| InChI | InChI=1S/C18H32N4S/c1-15(14-23-18(2,3)4)19-12-16-6-7-17(20-13-16)22-10-8-21(5)9-11-22/h6-7,13,15,19H,8-12,14H2,1-5H3 |
| InChIKey | XSRWOZZONDXJJR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |