C18H24FN5O2S — CID 147798190
10-fluoro-11-(4-methylpiperazin-1-yl)-8-oxo-1,3,4,12-tetrahydro-[1,4]thiazino[3,4-j]quinoline-7-carbohydrazide (PubChem CID 147798190) has the molecular formula C18H24FN5O2S and a molecular weight of 393.49 g/mol. Its IUPAC name is 10-fluoro-11-(4-methylpiperazin-1-yl)-8-oxo-1,3,4,12-tetrahydro-[1,4]thiazino[3,4-j]quinoline-7-carbohydrazide.
| Compound Name | 10-fluoro-11-(4-methylpiperazin-1-yl)-8-oxo-1,3,4,12-tetrahydro-[1,4]thiazino[3,4-j]quinoline-7-carbohydrazide |
|---|---|
| PubChem CID | 147798190 |
| Molecular Formula | C18H24FN5O2S |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 10-fluoro-11-(4-methylpiperazin-1-yl)-8-oxo-1,3,4,12-tetrahydro-[1,4]thiazino[3,4-j]quinoline-7-carbohydrazide |
| SMILES | CN1CCN(C2=C(F)C=C3C(=O)C(C(=O)NN)=CN4CCSCC34C2)CC1 |
| InChI | InChI=1S/C18H24FN5O2S/c1-22-2-4-23(5-3-22)15-9-18-11-27-7-6-24(18)10-12(17(26)21-20)16(25)13(18)8-14(15)19/h8,10H,2-7,9,11,20H2,1H3,(H,21,26) |
| InChIKey | HKZKAZYXWYPPBN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|