C19H25FN6O2 — CID 163659369
7-fluoro-10-imino-6-(4-methylpiperazin-1-yl)spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,11-triene-2,1'-cyclopropane]-11-carbohydrazide (PubChem CID 163659369) has the molecular formula C19H25FN6O2 and a molecular weight of 388.45 g/mol. Its IUPAC name is 7-fluoro-10-imino-6-(4-methylpiperazin-1-yl)spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,11-triene-2,1'-cyclopropane]-11-carbohydrazide.
| Compound Name | 7-fluoro-10-imino-6-(4-methylpiperazin-1-yl)spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,11-triene-2,1'-cyclopropane]-11-carbohydrazide |
|---|---|
| PubChem CID | 163659369 |
| Molecular Formula | C19H25FN6O2 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 7-fluoro-10-imino-6-(4-methylpiperazin-1-yl)spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,11-triene-2,1'-cyclopropane]-11-carbohydrazide |
| SMILES | [H]/N=C1/C(C(=O)NN)=CN2C3=C(OCC24CC4)C(N2CCN(C)CC2)=C(F)CC31 |
| InChI | InChI=1S/C19H25FN6O2/c1-24-4-6-25(7-5-24)16-13(20)8-11-14(21)12(18(27)23-22)9-26-15(11)17(16)28-10-19(26)2-3-19/h9,11,21H,2-8,10,22H2,1H3,(H,23,27)/b21-14+ |
| InChIKey | ITBAWEOWXVVAJS-KGENOOAVSA-N |
| XLogP | 0.42 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|