C15H24N6O2 — CID 177253126
1-ethyl-3-[4-(hydrazinecarbonyl)-2-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 177253126) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-ethyl-3-[4-(hydrazinecarbonyl)-2-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-ethyl-3-[4-(hydrazinecarbonyl)-2-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 177253126 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-ethyl-3-[4-(hydrazinecarbonyl)-2-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | CCNC(=O)Nc1ccc(C(=O)NN)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C15H24N6O2/c1-3-17-15(23)18-12-5-4-11(14(22)19-16)10-13(12)21-8-6-20(2)7-9-21/h4-5,10H,3,6-9,16H2,1-2H3,(H,19,22)(H2,17,18,23) |
| InChIKey | IKQDVONGRGNSPA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|