C17H21ClN4O3 — CID 177253186
1-ethyl-3-[4-(hydrazinecarbonyl)-2-(4-methoxyphenyl)phenyl]urea;hydrochloride (PubChem CID 177253186) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 1-ethyl-3-[4-(hydrazinecarbonyl)-2-(4-methoxyphenyl)phenyl]urea;hydrochloride.
| Compound Name | 1-ethyl-3-[4-(hydrazinecarbonyl)-2-(4-methoxyphenyl)phenyl]urea;hydrochloride |
|---|---|
| PubChem CID | 177253186 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-ethyl-3-[4-(hydrazinecarbonyl)-2-(4-methoxyphenyl)phenyl]urea;hydrochloride |
| SMILES | CCNC(=O)Nc1ccc(C(=O)NN)cc1-c1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C17H20N4O3.ClH/c1-3-19-17(23)20-15-9-6-12(16(22)21-18)10-14(15)11-4-7-13(24-2)8-5-11;/h4-10H,3,18H2,1-2H3,(H,21,22)(H2,19,20,23);1H |
| InChIKey | ZJKUUIMXTKVTEX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|