C20H23N3O4 — CID 118536103
3-(4-methylpiperazin-1-yl)-4-(phenylmethoxycarbonylamino)benzoic acid (PubChem CID 118536103) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-4-(phenylmethoxycarbonylamino)benzoic acid.
| Compound Name | 3-(4-methylpiperazin-1-yl)-4-(phenylmethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 118536103 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-4-(phenylmethoxycarbonylamino)benzoic acid |
| SMILES | CN1CCN(c2cc(C(=O)O)ccc2NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N3O4/c1-22-9-11-23(12-10-22)18-13-16(19(24)25)7-8-17(18)21-20(26)27-14-15-5-3-2-4-6-15/h2-8,13H,9-12,14H2,1H3,(H,21,26)(H,24,25) |
| InChIKey | ATJHNTFQFOGIJS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |