C19H21N3O4 — CID 90204404
benzyl N-(5-carbamoyl-2-morpholin-4-ylphenyl)carbamate (PubChem CID 90204404) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is benzyl N-(5-carbamoyl-2-morpholin-4-ylphenyl)carbamate.
| Compound Name | benzyl N-(5-carbamoyl-2-morpholin-4-ylphenyl)carbamate |
|---|---|
| PubChem CID | 90204404 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | benzyl N-(5-carbamoyl-2-morpholin-4-ylphenyl)carbamate |
| SMILES | NC(=O)c1ccc(N2CCOCC2)c(NC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H21N3O4/c20-18(23)15-6-7-17(22-8-10-25-11-9-22)16(12-15)21-19(24)26-13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H2,20,23)(H,21,24) |
| InChIKey | OUWQJKUWGVNSNH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |