C14H22F2N2 — CID 177032628
1-(3,5-difluoro-4-methylphenyl)-4-methylpiperazine;ethane (PubChem CID 177032628) has the molecular formula C14H22F2N2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-(3,5-difluoro-4-methylphenyl)-4-methylpiperazine;ethane.
| Compound Name | 1-(3,5-difluoro-4-methylphenyl)-4-methylpiperazine;ethane |
|---|---|
| PubChem CID | 177032628 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-(3,5-difluoro-4-methylphenyl)-4-methylpiperazine;ethane |
| SMILES | CC.Cc1c(F)cc(N2CCN(C)CC2)cc1F |
| InChI | InChI=1S/C12H16F2N2.C2H6/c1-9-11(13)7-10(8-12(9)14)16-5-3-15(2)4-6-16;1-2/h7-8H,3-6H2,1-2H3;1-2H3 |
| InChIKey | XBZHAPXYNVZNDH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |