C11H14F2N2O — CID 59447679
2,5-difluoro-4-(4-methylpiperazin-1-yl)phenol (PubChem CID 59447679) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is 2,5-difluoro-4-(4-methylpiperazin-1-yl)phenol.
| Compound Name | 2,5-difluoro-4-(4-methylpiperazin-1-yl)phenol |
|---|---|
| PubChem CID | 59447679 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2,5-difluoro-4-(4-methylpiperazin-1-yl)phenol |
| SMILES | CN1CCN(c2cc(F)c(O)cc2F)CC1 |
| InChI | InChI=1S/C11H14F2N2O/c1-14-2-4-15(5-3-14)10-6-9(13)11(16)7-8(10)12/h6-7,16H,2-5H2,1H3 |
| InChIKey | OPBIIIAPDKNSSN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |