C23H27FN2O2 — CID 170703450
ethane;5-fluoro-3-(4-methylphenyl)-7-(4-methylpiperazin-1-yl)chromen-2-one (PubChem CID 170703450) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is ethane;5-fluoro-3-(4-methylphenyl)-7-(4-methylpiperazin-1-yl)chromen-2-one.
| Compound Name | ethane;5-fluoro-3-(4-methylphenyl)-7-(4-methylpiperazin-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 170703450 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | ethane;5-fluoro-3-(4-methylphenyl)-7-(4-methylpiperazin-1-yl)chromen-2-one |
| SMILES | CC.Cc1ccc(-c2cc3c(F)cc(N4CCN(C)CC4)cc3oc2=O)cc1 |
| InChI | InChI=1S/C21H21FN2O2.C2H6/c1-14-3-5-15(6-4-14)17-13-18-19(22)11-16(12-20(18)26-21(17)25)24-9-7-23(2)8-10-24;1-2/h3-6,11-13H,7-10H2,1-2H3;1-2H3 |
| InChIKey | LIHREGYXHJSWKN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|