C54H34O6 — CID 142252710
2-[4-[3,5-bis(8-methyl-3-oxobenzo[f]chromen-2-yl)phenyl]phenyl]-8-methylbenzo[f]chromen-3-one (PubChem CID 142252710) has the molecular formula C54H34O6 and a molecular weight of 778.86 g/mol. Its IUPAC name is 2-[4-[3,5-bis(8-methyl-3-oxobenzo[f]chromen-2-yl)phenyl]phenyl]-8-methylbenzo[f]chromen-3-one.
| Compound Name | 2-[4-[3,5-bis(8-methyl-3-oxobenzo[f]chromen-2-yl)phenyl]phenyl]-8-methylbenzo[f]chromen-3-one |
|---|---|
| PubChem CID | 142252710 |
| Molecular Formula | C54H34O6 |
| Molecular Weight | 778.86 g/mol |
| Exact Mass | 778.24 |
| IUPAC Name | 2-[4-[3,5-bis(8-methyl-3-oxobenzo[f]chromen-2-yl)phenyl]phenyl]-8-methylbenzo[f]chromen-3-one |
| SMILES | Cc1ccc2c(ccc3oc(=O)c(-c4ccc(-c5cc(-c6cc7c(ccc8cc(C)ccc87)oc6=O)cc(-c6cc7c(ccc8cc(C)ccc87)oc6=O)c5)cc4)cc32)c1 |
| InChI | InChI=1S/C54H34O6/c1-29-4-14-40-34(20-29)11-17-49-46(40)26-43(52(55)58-49)33-9-7-32(8-10-33)37-23-38(44-27-47-41-15-5-30(2)21-35(41)12-18-50(47)59-53(44)56)25-39(24-37)45-28-48-42-16-6-31(3)22-36(42)13-19-51(48)60-54(45)57/h4-28H,1-3H3 |
| InChIKey | XMYFEZVKZVZVIZ-UHFFFAOYSA-N |
| XLogP | 13.06 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.86 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|