C20H21F5N4O4S2 — CID 160857543
2,2,3,3,5,5,6,6-octadeuterio-4-(2,6-difluoro-4-nitrophenyl)thiomorpholine;2,2,3,3,5,5,6,6-octadeuteriothiomorpholine;1,2,3-trifluoro-5-nitrobenzene (PubChem CID 160857543) has the molecular formula C20H21F5N4O4S2 and a molecular weight of 556.63 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octadeuterio-4-(2,6-difluoro-4-nitrophenyl)thiomorpholine;2,2,3,3,5,5,6,6-octadeuteriothiomorpholine;1,2,3-trifluoro-5-nitrobenzene.
| Compound Name | 2,2,3,3,5,5,6,6-octadeuterio-4-(2,6-difluoro-4-nitrophenyl)thiomorpholine;2,2,3,3,5,5,6,6-octadeuteriothiomorpholine;1,2,3-trifluoro-5-nitrobenzene |
|---|---|
| PubChem CID | 160857543 |
| Molecular Formula | C20H21F5N4O4S2 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octadeuterio-4-(2,6-difluoro-4-nitrophenyl)thiomorpholine;2,2,3,3,5,5,6,6-octadeuteriothiomorpholine;1,2,3-trifluoro-5-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(F)c(F)c(F)c1.[2H]C1([2H])NC([2H])([2H])C([2H])([2H])SC1([2H])[2H].[2H]C1([2H])SC([2H])([2H])C([2H])([2H])N(c2c(F)cc([N+](=O)[O-])cc2F)C1([2H])[2H] |
| InChI | InChI=1S/C10H10F2N2O2S.C6H2F3NO2.C4H9NS/c11-8-5-7(14(15)16)6-9(12)10(8)13-1-3-17-4-2-13;7-4-1-3(10(11)12)2-5(8)6(4)9;1-3-6-4-2-5-1/h5-6H,1-4H2;1-2H;5H,1-4H2/i1D2,2D2,3D2,4D2;;1D2,2D2,3D2,4D2 |
| InChIKey | SKBCZTNPIDYXJD-SLXWXECDSA-N |
| XLogP | 4.76 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|