C8H7FN2O4S — CID 154880726
5-nitro-1,3-dihydroisoindole-2-sulfonyl fluoride (PubChem CID 154880726) has the molecular formula C8H7FN2O4S and a molecular weight of 246.22 g/mol. Its IUPAC name is 5-nitro-1,3-dihydroisoindole-2-sulfonyl fluoride.
| Compound Name | 5-nitro-1,3-dihydroisoindole-2-sulfonyl fluoride |
|---|---|
| PubChem CID | 154880726 |
| Molecular Formula | C8H7FN2O4S |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 5-nitro-1,3-dihydroisoindole-2-sulfonyl fluoride |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CN(S(=O)(=O)F)C2 |
| InChI | InChI=1S/C8H7FN2O4S/c9-16(14,15)10-4-6-1-2-8(11(12)13)3-7(6)5-10/h1-3H,4-5H2 |
| InChIKey | QGBGQOWHMCQESN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|