C11H11FN2O3 — CID 174656563
2-fluoro-2-(5-nitro-1,3-dihydroisoindol-2-yl)propanal (PubChem CID 174656563) has the molecular formula C11H11FN2O3 and a molecular weight of 238.22 g/mol. Its IUPAC name is 2-fluoro-2-(5-nitro-1,3-dihydroisoindol-2-yl)propanal.
| Compound Name | 2-fluoro-2-(5-nitro-1,3-dihydroisoindol-2-yl)propanal |
|---|---|
| PubChem CID | 174656563 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-fluoro-2-(5-nitro-1,3-dihydroisoindol-2-yl)propanal |
| SMILES | CC(F)(C=O)N1Cc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C11H11FN2O3/c1-11(12,7-15)13-5-8-2-3-10(14(16)17)4-9(8)6-13/h2-4,7H,5-6H2,1H3 |
| InChIKey | NQVBTNBIEFKPQP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|