About 5-nitro-3H-indole
5-nitro-3H-indole (PubChem CID 22320744) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 5-nitro-3H-indole.
Molecular Properties
| Compound Name | 5-nitro-3H-indole |
| PubChem CID | 22320744 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 5-nitro-3H-indole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CC=N2 |
| InChI | InChI=1S/C8H6N2O2/c11-10(12)7-1-2-8-6(5-7)3-4-9-8/h1-2,4-5H,3H2 |
| InChIKey | ZEKRQFCQJOETIO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-3H-indole?
The IUPAC name of 5-nitro-3H-indole (CID 22320744) is 5-nitro-3H-indole.
What is the SMILES notation for 5-nitro-3H-indole?
The canonical SMILES for 5-nitro-3H-indole is O=[N+]([O-])c1ccc2c(c1)CC=N2.
What is the InChIKey of 5-nitro-3H-indole?
The InChIKey is ZEKRQFCQJOETIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c11-10(12)7-1-2-8-6(5-7)3-4-9-8/h1-2,4-5H,3H2.
What are the key properties of 5-nitro-3H-indole?
5-nitro-3H-indole has a molecular weight of 162.15 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-3H-indole is sourced from PubChem (CID 22320744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).