C7H5N3O2S — CID 150516987
7-nitro-2H-1,2,4-benzothiadiazine (PubChem CID 150516987) has the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. Its IUPAC name is 7-nitro-2H-1,2,4-benzothiadiazine.
| Compound Name | 7-nitro-2H-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 150516987 |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 7-nitro-2H-1,2,4-benzothiadiazine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)SNC=N2 |
| InChI | InChI=1S/C7H5N3O2S/c11-10(12)5-1-2-6-7(3-5)13-9-4-8-6/h1-4H,(H,8,9) |
| InChIKey | IBAFKJJPXIXQEO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|