C11H13N3O2S — CID 91387045
4-cyclobutyl-7-nitro-2,3-dihydro-1,2,4-benzothiadiazine (PubChem CID 91387045) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-cyclobutyl-7-nitro-2,3-dihydro-1,2,4-benzothiadiazine.
| Compound Name | 4-cyclobutyl-7-nitro-2,3-dihydro-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 91387045 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4-cyclobutyl-7-nitro-2,3-dihydro-1,2,4-benzothiadiazine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)SNCN2C1CCC1 |
| InChI | InChI=1S/C11H13N3O2S/c15-14(16)9-4-5-10-11(6-9)17-12-7-13(10)8-2-1-3-8/h4-6,8,12H,1-3,7H2 |
| InChIKey | GDYANPGRRZRWDI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|