C13H17N3O2 — CID 22037978
6-nitro-1-piperidin-4-yl-2,3-dihydroindole (PubChem CID 22037978) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 6-nitro-1-piperidin-4-yl-2,3-dihydroindole.
| Compound Name | 6-nitro-1-piperidin-4-yl-2,3-dihydroindole |
|---|---|
| PubChem CID | 22037978 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 6-nitro-1-piperidin-4-yl-2,3-dihydroindole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)N(C1CCNCC1)CC2 |
| InChI | InChI=1S/C13H17N3O2/c17-16(18)12-2-1-10-5-8-15(13(10)9-12)11-3-6-14-7-4-11/h1-2,9,11,14H,3-8H2 |
| InChIKey | HUSWWXPSZVHXHJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|