About 8-nitro-1H-perimidine
8-nitro-1H-perimidine (PubChem CID 15446168) has the molecular formula C11H7N3O2
and a molecular weight of 213.20 g/mol. Its IUPAC name is 8-nitro-1H-perimidine.
Molecular Properties
| Compound Name | 8-nitro-1H-perimidine |
| PubChem CID | 15446168 |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 8-nitro-1H-perimidine |
| SMILES | O=[N+]([O-])c1cc2c3c(cccc3c1)N=CN2 |
| InChI | InChI=1S/C11H7N3O2/c15-14(16)8-4-7-2-1-3-9-11(7)10(5-8)13-6-12-9/h1-6H,(H,12,13) |
| InChIKey | QZYKETRLIRHIAP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitro-1H-perimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitro-1H-perimidine?
The IUPAC name of 8-nitro-1H-perimidine (CID 15446168) is 8-nitro-1H-perimidine.
What is the SMILES notation for 8-nitro-1H-perimidine?
The canonical SMILES for 8-nitro-1H-perimidine is O=[N+]([O-])c1cc2c3c(cccc3c1)N=CN2.
What is the InChIKey of 8-nitro-1H-perimidine?
The InChIKey is QZYKETRLIRHIAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O2/c15-14(16)8-4-7-2-1-3-9-11(7)10(5-8)13-6-12-9/h1-6H,(H,12,13).
What are the key properties of 8-nitro-1H-perimidine?
8-nitro-1H-perimidine has a molecular weight of 213.20 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitro-1H-perimidine is sourced from PubChem (CID 15446168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).