About 1H-indole;5-nitro-1H-indole
1H-indole;5-nitro-1H-indole (PubChem CID 172790290) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is 1H-indole;5-nitro-1H-indole.
Molecular Properties
| Compound Name | 1H-indole;5-nitro-1H-indole |
| PubChem CID | 172790290 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1H-indole;5-nitro-1H-indole |
| SMILES | O=[N+]([O-])c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H6N2O2.C8H7N/c11-10(12)7-1-2-8-6(5-7)3-4-9-8;1-2-4-8-7(3-1)5-6-9-8/h1-5,9H;1-6,9H |
| InChIKey | PLYQWSUKPBJOLY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 74.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole;5-nitro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;5-nitro-1H-indole?
The IUPAC name of 1H-indole;5-nitro-1H-indole (CID 172790290) is 1H-indole;5-nitro-1H-indole.
What is the SMILES notation for 1H-indole;5-nitro-1H-indole?
The canonical SMILES for 1H-indole;5-nitro-1H-indole is O=[N+]([O-])c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;5-nitro-1H-indole?
The InChIKey is PLYQWSUKPBJOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2.C8H7N/c11-10(12)7-1-2-8-6(5-7)3-4-9-8;1-2-4-8-7(3-1)5-6-9-8/h1-5,9H;1-6,9H.
What are the key properties of 1H-indole;5-nitro-1H-indole?
1H-indole;5-nitro-1H-indole has a molecular weight of 279.30 g/mol, XLogP of 4.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;5-nitro-1H-indole is sourced from PubChem (CID 172790290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).