About 5-nitro-1H-indole;1H-phosphole-2-carboxamide
5-nitro-1H-indole;1H-phosphole-2-carboxamide (PubChem CID 158250465) has the molecular formula C13H12N3O3P
and a molecular weight of 289.23 g/mol. Its IUPAC name is 5-nitro-1H-indole;1H-phosphole-2-carboxamide.
Molecular Properties
| Compound Name | 5-nitro-1H-indole;1H-phosphole-2-carboxamide |
| PubChem CID | 158250465 |
| Molecular Formula | C13H12N3O3P |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 5-nitro-1H-indole;1H-phosphole-2-carboxamide |
| SMILES | NC(=O)c1ccc[pH]1.O=[N+]([O-])c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H6N2O2.C5H6NOP/c11-10(12)7-1-2-8-6(5-7)3-4-9-8;6-5(7)4-2-1-3-8-4/h1-5,9H;1-3,8H,(H2,6,7) |
| InChIKey | GGQNDCXTSAMWHH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1H-indole;1H-phosphole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1H-indole;1H-phosphole-2-carboxamide?
The IUPAC name of 5-nitro-1H-indole;1H-phosphole-2-carboxamide (CID 158250465) is 5-nitro-1H-indole;1H-phosphole-2-carboxamide.
What is the SMILES notation for 5-nitro-1H-indole;1H-phosphole-2-carboxamide?
The canonical SMILES for 5-nitro-1H-indole;1H-phosphole-2-carboxamide is NC(=O)c1ccc[pH]1.O=[N+]([O-])c1ccc2[nH]ccc2c1.
What is the InChIKey of 5-nitro-1H-indole;1H-phosphole-2-carboxamide?
The InChIKey is GGQNDCXTSAMWHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2.C5H6NOP/c11-10(12)7-1-2-8-6(5-7)3-4-9-8;6-5(7)4-2-1-3-8-4/h1-5,9H;1-3,8H,(H2,6,7).
What are the key properties of 5-nitro-1H-indole;1H-phosphole-2-carboxamide?
5-nitro-1H-indole;1H-phosphole-2-carboxamide has a molecular weight of 289.23 g/mol, XLogP of 2.89, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1H-indole;1H-phosphole-2-carboxamide is sourced from PubChem (CID 158250465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).