C17H23F2N3O3 — CID 133396091
1-[3-(difluoromethoxy)-4-nitrophenyl]-4-(2-methylpyrrolidin-1-yl)piperidine (PubChem CID 133396091) has the molecular formula C17H23F2N3O3 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)-4-nitrophenyl]-4-(2-methylpyrrolidin-1-yl)piperidine.
| Compound Name | 1-[3-(difluoromethoxy)-4-nitrophenyl]-4-(2-methylpyrrolidin-1-yl)piperidine |
|---|---|
| PubChem CID | 133396091 |
| Molecular Formula | C17H23F2N3O3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[3-(difluoromethoxy)-4-nitrophenyl]-4-(2-methylpyrrolidin-1-yl)piperidine |
| SMILES | CC1CCCN1C1CCN(c2ccc([N+](=O)[O-])c(OC(F)F)c2)CC1 |
| InChI | InChI=1S/C17H23F2N3O3/c1-12-3-2-8-21(12)13-6-9-20(10-7-13)14-4-5-15(22(23)24)16(11-14)25-17(18)19/h4-5,11-13,17H,2-3,6-10H2,1H3 |
| InChIKey | CVUQWOOHMUMFJU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|