C15H16F2N4O3 — CID 133429001
1-[3-(difluoromethoxy)-4-nitrophenyl]-2-(1H-imidazol-2-yl)piperidine (PubChem CID 133429001) has the molecular formula C15H16F2N4O3 and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)-4-nitrophenyl]-2-(1H-imidazol-2-yl)piperidine.
| Compound Name | 1-[3-(difluoromethoxy)-4-nitrophenyl]-2-(1H-imidazol-2-yl)piperidine |
|---|---|
| PubChem CID | 133429001 |
| Molecular Formula | C15H16F2N4O3 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[3-(difluoromethoxy)-4-nitrophenyl]-2-(1H-imidazol-2-yl)piperidine |
| SMILES | O=[N+]([O-])c1ccc(N2CCCCC2c2ncc[nH]2)cc1OC(F)F |
| InChI | InChI=1S/C15H16F2N4O3/c16-15(17)24-13-9-10(4-5-11(13)21(22)23)20-8-2-1-3-12(20)14-18-6-7-19-14/h4-7,9,12,15H,1-3,8H2,(H,18,19) |
| InChIKey | GWZREIBKKRYCCG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|