C11H12FN3O3 — CID 105381860
2-(2-carbamoylpyrrolidin-1-yl)-3-fluoropyridine-4-carboxylic acid (PubChem CID 105381860) has the molecular formula C11H12FN3O3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 2-(2-carbamoylpyrrolidin-1-yl)-3-fluoropyridine-4-carboxylic acid.
| Compound Name | 2-(2-carbamoylpyrrolidin-1-yl)-3-fluoropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105381860 |
| Molecular Formula | C11H12FN3O3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(2-carbamoylpyrrolidin-1-yl)-3-fluoropyridine-4-carboxylic acid |
| SMILES | NC(=O)C1CCCN1c1nccc(C(=O)O)c1F |
| InChI | InChI=1S/C11H12FN3O3/c12-8-6(11(17)18)3-4-14-10(8)15-5-1-2-7(15)9(13)16/h3-4,7H,1-2,5H2,(H2,13,16)(H,17,18) |
| InChIKey | OAJHKBLPAICEAP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |