C11H17N5O — CID 62672889
1-[3-(aminomethyl)pyrazin-2-yl]piperidine-2-carboxamide (PubChem CID 62672889) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-[3-(aminomethyl)pyrazin-2-yl]piperidine-2-carboxamide.
| Compound Name | 1-[3-(aminomethyl)pyrazin-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 62672889 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-[3-(aminomethyl)pyrazin-2-yl]piperidine-2-carboxamide |
| SMILES | NCc1nccnc1N1CCCCC1C(N)=O |
| InChI | InChI=1S/C11H17N5O/c12-7-8-11(15-5-4-14-8)16-6-2-1-3-9(16)10(13)17/h4-5,9H,1-3,6-7,12H2,(H2,13,17) |
| InChIKey | NMLPONKMOHQPNW-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |