C12H16N4O4 — CID 62823957
2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62823957) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 62823957 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(c2ncccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H16N4O4/c17-11(18)9-14-5-2-6-15(8-7-14)12-10(16(19)20)3-1-4-13-12/h1,3-4H,2,5-9H2,(H,17,18) |
| InChIKey | YHIOWSNPKMTIHP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|