2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid

C12H16N4O4 — CID 62823957

IUPAC2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(c2ncccc2[N+](=O)[O-])CC1
InChIInChI=1S/C12H16N4O4/c17-11(18)9-14-5-2-6-15(8-7-14)12-10(16(19)20)3-1-4-13-12/h1,3-4H,2,5-9H2,(H,17,18)
InChIKeyYHIOWSNPKMTIHP-UHFFFAOYSA-N
MW280.28 g/mol
LogP0.59
Rot. Bonds4

About 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid

2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62823957) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid
PubChem CID62823957
Molecular FormulaC12H16N4O4
Molecular Weight280.28 g/mol
Exact Mass280.12
IUPAC Name2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(c2ncccc2[N+](=O)[O-])CC1
InChIInChI=1S/C12H16N4O4/c17-11(18)9-14-5-2-6-15(8-7-14)12-10(16(19)20)3-1-4-13-12/h1,3-4H,2,5-9H2,(H,17,18)
InChIKeyYHIOWSNPKMTIHP-UHFFFAOYSA-N
XLogP0.59
TPSA99.81 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.28
LogP ≤ 50.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid (CID 62823957) is 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid is O=C(O)CN1CCCN(c2ncccc2[N+](=O)[O-])CC1.
What is the InChIKey of 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid?
The InChIKey is YHIOWSNPKMTIHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O4/c17-11(18)9-14-5-2-6-15(8-7-14)12-10(16(19)20)3-1-4-13-12/h1,3-4H,2,5-9H2,(H,17,18).
What are the key properties of 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid?
2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid has a molecular weight of 280.28 g/mol, XLogP of 0.59, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 62823957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).