C16H25N5O2 — CID 95309066
1-[[(2S)-1-methylpiperidin-2-yl]methyl]-4-(3-nitro-2-pyridinyl)piperazine (PubChem CID 95309066) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-[[(2S)-1-methylpiperidin-2-yl]methyl]-4-(3-nitro-2-pyridinyl)piperazine.
| Compound Name | 1-[[(2S)-1-methylpiperidin-2-yl]methyl]-4-(3-nitro-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 95309066 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 1-[[(2S)-1-methylpiperidin-2-yl]methyl]-4-(3-nitro-2-pyridinyl)piperazine |
| SMILES | CN1CCCC[C@H]1CN1CCN(c2ncccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H25N5O2/c1-18-8-3-2-5-14(18)13-19-9-11-20(12-10-19)16-15(21(22)23)6-4-7-17-16/h4,6-7,14H,2-3,5,8-13H2,1H3/t14-/m0/s1 |
| InChIKey | LPRPRHCCVFIJEA-AWEZNQCLSA-N |
| XLogP | 1.60 |
| TPSA | 65.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|