C10H15N5O4 — CID 103079255
2-[4-(1-methyl-4-nitropyrazol-3-yl)piperazin-1-yl]acetic acid (PubChem CID 103079255) has the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-[4-(1-methyl-4-nitropyrazol-3-yl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(1-methyl-4-nitropyrazol-3-yl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 103079255 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-[4-(1-methyl-4-nitropyrazol-3-yl)piperazin-1-yl]acetic acid |
| SMILES | Cn1cc([N+](=O)[O-])c(N2CCN(CC(=O)O)CC2)n1 |
| InChI | InChI=1S/C10H15N5O4/c1-12-6-8(15(18)19)10(11-12)14-4-2-13(3-5-14)7-9(16)17/h6H,2-5,7H2,1H3,(H,16,17) |
| InChIKey | TXCQFABJUVEMFB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|