C10H11N5O4 — CID 103080478
3,5-dimethyl-1-(1-methyl-4-nitropyrazol-3-yl)pyrazole-4-carboxylic acid (PubChem CID 103080478) has the molecular formula C10H11N5O4 and a molecular weight of 265.23 g/mol. Its IUPAC name is 3,5-dimethyl-1-(1-methyl-4-nitropyrazol-3-yl)pyrazole-4-carboxylic acid.
| Compound Name | 3,5-dimethyl-1-(1-methyl-4-nitropyrazol-3-yl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103080478 |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 3,5-dimethyl-1-(1-methyl-4-nitropyrazol-3-yl)pyrazole-4-carboxylic acid |
| SMILES | Cc1nn(-c2nn(C)cc2[N+](=O)[O-])c(C)c1C(=O)O |
| InChI | InChI=1S/C10H11N5O4/c1-5-8(10(16)17)6(2)14(11-5)9-7(15(18)19)4-13(3)12-9/h4H,1-3H3,(H,16,17) |
| InChIKey | RNENCHNFYCDQPO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|