C8H12N4O3 — CID 103080430
[1-(1-methyl-4-nitropyrazol-3-yl)azetidin-3-yl]methanol (PubChem CID 103080430) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is [1-(1-methyl-4-nitropyrazol-3-yl)azetidin-3-yl]methanol.
| Compound Name | [1-(1-methyl-4-nitropyrazol-3-yl)azetidin-3-yl]methanol |
|---|---|
| PubChem CID | 103080430 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | [1-(1-methyl-4-nitropyrazol-3-yl)azetidin-3-yl]methanol |
| SMILES | Cn1cc([N+](=O)[O-])c(N2CC(CO)C2)n1 |
| InChI | InChI=1S/C8H12N4O3/c1-10-4-7(12(14)15)8(9-10)11-2-6(3-11)5-13/h4,6,13H,2-3,5H2,1H3 |
| InChIKey | OCTNINBNZWXHHU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|