C10H14N4O6S — CID 103079385
2-[4-(1-methyl-4-nitropyrazol-3-yl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid (PubChem CID 103079385) has the molecular formula C10H14N4O6S and a molecular weight of 318.31 g/mol. Its IUPAC name is 2-[4-(1-methyl-4-nitropyrazol-3-yl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid.
| Compound Name | 2-[4-(1-methyl-4-nitropyrazol-3-yl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
|---|---|
| PubChem CID | 103079385 |
| Molecular Formula | C10H14N4O6S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-[4-(1-methyl-4-nitropyrazol-3-yl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
| SMILES | Cn1cc([N+](=O)[O-])c(N2CCS(=O)(=O)CC2CC(=O)O)n1 |
| InChI | InChI=1S/C10H14N4O6S/c1-12-5-8(14(17)18)10(11-12)13-2-3-21(19,20)6-7(13)4-9(15)16/h5,7H,2-4,6H2,1H3,(H,15,16) |
| InChIKey | NFSFWVCQJUUJQW-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|