C11H13N3O6S — CID 80514936
2-[4-(6-nitro-3-pyridinyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid (PubChem CID 80514936) has the molecular formula C11H13N3O6S and a molecular weight of 315.31 g/mol. Its IUPAC name is 2-[4-(6-nitro-3-pyridinyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid.
| Compound Name | 2-[4-(6-nitro-3-pyridinyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
|---|---|
| PubChem CID | 80514936 |
| Molecular Formula | C11H13N3O6S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-[4-(6-nitro-3-pyridinyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
| SMILES | O=C(O)CC1CS(=O)(=O)CCN1c1ccc([N+](=O)[O-])nc1 |
| InChI | InChI=1S/C11H13N3O6S/c15-11(16)5-9-7-21(19,20)4-3-13(9)8-1-2-10(12-6-8)14(17)18/h1-2,6,9H,3-5,7H2,(H,15,16) |
| InChIKey | MIKLSEOMJFLMRH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|