C13H16FN3O4 — CID 62824669
2-[4-(3-fluoro-2-nitrophenyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62824669) has the molecular formula C13H16FN3O4 and a molecular weight of 297.29 g/mol. Its IUPAC name is 2-[4-(3-fluoro-2-nitrophenyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(3-fluoro-2-nitrophenyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 62824669 |
| Molecular Formula | C13H16FN3O4 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[4-(3-fluoro-2-nitrophenyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(c2cccc(F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H16FN3O4/c14-10-3-1-4-11(13(10)17(20)21)16-6-2-5-15(7-8-16)9-12(18)19/h1,3-4H,2,5-9H2,(H,18,19) |
| InChIKey | BCVRNGLTOIIZMT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|