C15H16N4O4S — CID 124888834
methyl 5-methyl-2-[(2R)-1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate (PubChem CID 124888834) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is methyl 5-methyl-2-[(2R)-1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-methyl-2-[(2R)-1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 124888834 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | methyl 5-methyl-2-[(2R)-1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc([C@H]2CCCN2c2ncccc2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C15H16N4O4S/c1-9-12(15(20)23-2)17-14(24-9)11-6-4-8-18(11)13-10(19(21)22)5-3-7-16-13/h3,5,7,11H,4,6,8H2,1-2H3/t11-/m1/s1 |
| InChIKey | QCBUSXFVHOVXGH-LLVKDONJSA-N |
| XLogP | 2.88 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|