C23H28ClN5O2 — CID 89202844
2-[[(2Z)-2-[amino-(3-methyl-2-pyridinyl)amino]-4-methylpenta-2,4-dienoyl]amino]-5-chloro-3-methyl-N-propan-2-ylbenzamide (PubChem CID 89202844) has the molecular formula C23H28ClN5O2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-[[(2Z)-2-[amino-(3-methyl-2-pyridinyl)amino]-4-methylpenta-2,4-dienoyl]amino]-5-chloro-3-methyl-N-propan-2-ylbenzamide.
| Compound Name | 2-[[(2Z)-2-[amino-(3-methyl-2-pyridinyl)amino]-4-methylpenta-2,4-dienoyl]amino]-5-chloro-3-methyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 89202844 |
| Molecular Formula | C23H28ClN5O2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-[[(2Z)-2-[amino-(3-methyl-2-pyridinyl)amino]-4-methylpenta-2,4-dienoyl]amino]-5-chloro-3-methyl-N-propan-2-ylbenzamide |
| SMILES | C=C(C)/C=C(/C(=O)Nc1c(C)cc(Cl)cc1C(=O)NC(C)C)N(N)c1ncccc1C |
| InChI | InChI=1S/C23H28ClN5O2/c1-13(2)10-19(29(25)21-15(5)8-7-9-26-21)23(31)28-20-16(6)11-17(24)12-18(20)22(30)27-14(3)4/h7-12,14H,1,25H2,2-6H3,(H,27,30)(H,28,31)/b19-10- |
| InChIKey | QOWRDGJNOQNCMH-GRSHGNNSSA-N |
| XLogP | 4.27 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|