C22H21Cl3F3N5O2 — CID 89330497
2-[[(2Z)-2-[amino-(3-chloro-2-pyridinyl)amino]-4-(trifluoromethyl)penta-2,4-dienoyl]amino]-N-tert-butyl-3,5-dichlorobenzamide (PubChem CID 89330497) has the molecular formula C22H21Cl3F3N5O2 and a molecular weight of 550.80 g/mol. Its IUPAC name is 2-[[(2Z)-2-[amino-(3-chloro-2-pyridinyl)amino]-4-(trifluoromethyl)penta-2,4-dienoyl]amino]-N-tert-butyl-3,5-dichlorobenzamide.
| Compound Name | 2-[[(2Z)-2-[amino-(3-chloro-2-pyridinyl)amino]-4-(trifluoromethyl)penta-2,4-dienoyl]amino]-N-tert-butyl-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 89330497 |
| Molecular Formula | C22H21Cl3F3N5O2 |
| Molecular Weight | 550.80 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 2-[[(2Z)-2-[amino-(3-chloro-2-pyridinyl)amino]-4-(trifluoromethyl)penta-2,4-dienoyl]amino]-N-tert-butyl-3,5-dichlorobenzamide |
| SMILES | C=C(/C=C(/C(=O)Nc1c(Cl)cc(Cl)cc1C(=O)NC(C)(C)C)N(N)c1ncccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C22H21Cl3F3N5O2/c1-11(22(26,27)28)8-16(33(29)18-14(24)6-5-7-30-18)20(35)31-17-13(9-12(23)10-15(17)25)19(34)32-21(2,3)4/h5-10H,1,29H2,2-4H3,(H,31,35)(H,32,34)/b16-8- |
| InChIKey | DSQBKISBWKEVHM-PXNMLYILSA-N |
| XLogP | 5.89 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.80 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|