C19H18Cl3N5O3 — CID 145498257
1-[(1E)-1-chlorobuta-1,3-dienyl]-3-[4-chloro-2-[(methoxyamino)carbamoyl]-6-methylphenyl]-1-(3-chloro-2-pyridinyl)urea (PubChem CID 145498257) has the molecular formula C19H18Cl3N5O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is 1-[(1E)-1-chlorobuta-1,3-dienyl]-3-[4-chloro-2-[(methoxyamino)carbamoyl]-6-methylphenyl]-1-(3-chloro-2-pyridinyl)urea.
| Compound Name | 1-[(1E)-1-chlorobuta-1,3-dienyl]-3-[4-chloro-2-[(methoxyamino)carbamoyl]-6-methylphenyl]-1-(3-chloro-2-pyridinyl)urea |
|---|---|
| PubChem CID | 145498257 |
| Molecular Formula | C19H18Cl3N5O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 1-[(1E)-1-chlorobuta-1,3-dienyl]-3-[4-chloro-2-[(methoxyamino)carbamoyl]-6-methylphenyl]-1-(3-chloro-2-pyridinyl)urea |
| SMILES | C=C/C=C(/Cl)N(C(=O)Nc1c(C)cc(Cl)cc1C(=O)NNOC)c1ncccc1Cl |
| InChI | InChI=1S/C19H18Cl3N5O3/c1-4-6-15(22)27(17-14(21)7-5-8-23-17)19(29)24-16-11(2)9-12(20)10-13(16)18(28)25-26-30-3/h4-10,26H,1H2,2-3H3,(H,24,29)(H,25,28)/b15-6- |
| InChIKey | IFEZINWCCGIZJA-UUASQNMZSA-N |
| XLogP | 4.80 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|