C20H16Cl3N5O4 — CID 59286838
methyl N-[[5-chloro-2-[[4-chloro-1-(3-chloro-2-pyridinyl)pyrrole-2-carbonyl]amino]-3-methylbenzoyl]amino]carbamate (PubChem CID 59286838) has the molecular formula C20H16Cl3N5O4 and a molecular weight of 496.74 g/mol. Its IUPAC name is methyl N-[[5-chloro-2-[[4-chloro-1-(3-chloro-2-pyridinyl)pyrrole-2-carbonyl]amino]-3-methylbenzoyl]amino]carbamate.
| Compound Name | methyl N-[[5-chloro-2-[[4-chloro-1-(3-chloro-2-pyridinyl)pyrrole-2-carbonyl]amino]-3-methylbenzoyl]amino]carbamate |
|---|---|
| PubChem CID | 59286838 |
| Molecular Formula | C20H16Cl3N5O4 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | methyl N-[[5-chloro-2-[[4-chloro-1-(3-chloro-2-pyridinyl)pyrrole-2-carbonyl]amino]-3-methylbenzoyl]amino]carbamate |
| SMILES | COC(=O)NNC(=O)c1cc(Cl)cc(C)c1NC(=O)c1cc(Cl)cn1-c1ncccc1Cl |
| InChI | InChI=1S/C20H16Cl3N5O4/c1-10-6-11(21)7-13(18(29)26-27-20(31)32-2)16(10)25-19(30)15-8-12(22)9-28(15)17-14(23)4-3-5-24-17/h3-9H,1-2H3,(H,25,30)(H,26,29)(H,27,31) |
| InChIKey | IJXGHBRXMOAHCR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|