C21H23Cl2N5O2 — CID 143438822
N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-4-methylpyrrole-2-carboxamide;ethane (PubChem CID 143438822) has the molecular formula C21H23Cl2N5O2 and a molecular weight of 448.35 g/mol. Its IUPAC name is N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-4-methylpyrrole-2-carboxamide;ethane.
| Compound Name | N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-4-methylpyrrole-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143438822 |
| Molecular Formula | C21H23Cl2N5O2 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-4-methylpyrrole-2-carboxamide;ethane |
| SMILES | CC.Cc1cc(C(=O)Nc2c(C)cc(Cl)cc2C(=O)NN)n(-c2ncccc2Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N5O2.C2H6/c1-10-6-15(26(9-10)17-14(21)4-3-5-23-17)19(28)24-16-11(2)7-12(20)8-13(16)18(27)25-22;1-2/h3-9H,22H2,1-2H3,(H,24,28)(H,25,27);1-2H3 |
| InChIKey | CHQSUPSPANHKHS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|