C18H15Cl2IN5O2+ — CID 163518143
N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(3-chloropyridin-1-ium-2-yl)-4-iodopyrrole-2-carboxamide (PubChem CID 163518143) has the molecular formula C18H15Cl2IN5O2+ and a molecular weight of 531.16 g/mol. Its IUPAC name is N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(3-chloropyridin-1-ium-2-yl)-4-iodopyrrole-2-carboxamide.
| Compound Name | N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(3-chloropyridin-1-ium-2-yl)-4-iodopyrrole-2-carboxamide |
|---|---|
| PubChem CID | 163518143 |
| Molecular Formula | C18H15Cl2IN5O2+ |
| Molecular Weight | 531.16 g/mol |
| Exact Mass | 529.96 |
| IUPAC Name | N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(3-chloropyridin-1-ium-2-yl)-4-iodopyrrole-2-carboxamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NN)c1NC(=O)c1cc(I)cn1-c1[nH+]cccc1Cl |
| InChI | InChI=1S/C18H14Cl2IN5O2/c1-9-5-10(19)6-12(17(27)25-22)15(9)24-18(28)14-7-11(21)8-26(14)16-13(20)3-2-4-23-16/h2-8H,22H2,1H3,(H,24,28)(H,25,27)/p+1 |
| InChIKey | DINCSMXZJUUDKN-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|