C20H19Cl4N6O2Y- — CID 145498302
[[5-chloro-2-[[(3-chloro-2-pyridinyl)-[(1Z)-1,2-dichlorobuta-1,3-dienyl]carbamoyl]amino]-3-methylbenzoyl]amino]-(dimethylamino)azanide;yttrium (PubChem CID 145498302) has the molecular formula C20H19Cl4N6O2Y- and a molecular weight of 606.13 g/mol. Its IUPAC name is [[5-chloro-2-[[(3-chloro-2-pyridinyl)-[(1Z)-1,2-dichlorobuta-1,3-dienyl]carbamoyl]amino]-3-methylbenzoyl]amino]-(dimethylamino)azanide;yttrium.
| Compound Name | [[5-chloro-2-[[(3-chloro-2-pyridinyl)-[(1Z)-1,2-dichlorobuta-1,3-dienyl]carbamoyl]amino]-3-methylbenzoyl]amino]-(dimethylamino)azanide;yttrium |
|---|---|
| PubChem CID | 145498302 |
| Molecular Formula | C20H19Cl4N6O2Y- |
| Molecular Weight | 606.13 g/mol |
| Exact Mass | 603.94 |
| IUPAC Name | [[5-chloro-2-[[(3-chloro-2-pyridinyl)-[(1Z)-1,2-dichlorobuta-1,3-dienyl]carbamoyl]amino]-3-methylbenzoyl]amino]-(dimethylamino)azanide;yttrium |
| SMILES | C=C/C(Cl)=C(/Cl)N(C(=O)Nc1c(C)cc(Cl)cc1C(=O)N[N-]N(C)C)c1ncccc1Cl.[Y] |
| InChI | InChI=1S/C20H19Cl4N6O2.Y/c1-5-14(22)17(24)30(18-15(23)7-6-8-25-18)20(32)26-16-11(2)9-12(21)10-13(16)19(31)27-28-29(3)4;/h5-10H,1H2,2-4H3,(H2,26,27,31,32);/q-1;/b17-14+; |
| InChIKey | ZLXZECDZUDLQHU-KLSJZZFUSA-N |
| XLogP | 6.06 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.13 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|