C11H9Cl2NO3 — CID 82335452
(Z)-4-(2,6-dichloroanilino)-3-methyl-4-oxobut-2-enoic acid (PubChem CID 82335452) has the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. Its IUPAC name is (Z)-4-(2,6-dichloroanilino)-3-methyl-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(2,6-dichloroanilino)-3-methyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 82335452 |
| Molecular Formula | C11H9Cl2NO3 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (Z)-4-(2,6-dichloroanilino)-3-methyl-4-oxobut-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H9Cl2NO3/c1-6(5-9(15)16)11(17)14-10-7(12)3-2-4-8(10)13/h2-5H,1H3,(H,14,17)(H,15,16)/b6-5- |
| InChIKey | CERVCPHIXLHHDE-WAYWQWQTSA-N |
| XLogP | 2.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|