C12H11Cl2NO3 — CID 77067975
4-(2,6-dichloroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 77067975) has the molecular formula C12H11Cl2NO3 and a molecular weight of 288.13 g/mol. Its IUPAC name is 4-(2,6-dichloroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-(2,6-dichloroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 77067975 |
| Molecular Formula | C12H11Cl2NO3 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 4-(2,6-dichloroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H11Cl2NO3/c1-6(7(2)12(17)18)11(16)15-10-8(13)4-3-5-9(10)14/h3-5H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | JJBMEZUNJVGWSE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|