C23H19ClFN3O3S — CID 123510404
4-tert-butyl-N-[7-chloro-2-(5-fluoro-2-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide (PubChem CID 123510404) has the molecular formula C23H19ClFN3O3S and a molecular weight of 471.94 g/mol. Its IUPAC name is 4-tert-butyl-N-[7-chloro-2-(5-fluoro-2-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide.
| Compound Name | 4-tert-butyl-N-[7-chloro-2-(5-fluoro-2-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide |
|---|---|
| PubChem CID | 123510404 |
| Molecular Formula | C23H19ClFN3O3S |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 4-tert-butyl-N-[7-chloro-2-(5-fluoro-2-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide |
| SMILES | CC(C)(C)c1ccc(S(=O)Nc2ccc(Cl)c3c2C(=O)N(c2ccc(F)cn2)C3=O)cc1 |
| InChI | InChI=1S/C23H19ClFN3O3S/c1-23(2,3)13-4-7-15(8-5-13)32(31)27-17-10-9-16(24)19-20(17)22(30)28(21(19)29)18-11-6-14(25)12-26-18/h4-12,27H,1-3H3 |
| InChIKey | MESPTAOQFYLRRU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|