C24H22ClN3O3S — CID 118204836
4-tert-butyl-N-[7-chloro-2-(4-methyl-2-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide (PubChem CID 118204836) has the molecular formula C24H22ClN3O3S and a molecular weight of 467.98 g/mol. Its IUPAC name is 4-tert-butyl-N-[7-chloro-2-(4-methyl-2-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide.
| Compound Name | 4-tert-butyl-N-[7-chloro-2-(4-methyl-2-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide |
|---|---|
| PubChem CID | 118204836 |
| Molecular Formula | C24H22ClN3O3S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 4-tert-butyl-N-[7-chloro-2-(4-methyl-2-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide |
| SMILES | Cc1ccnc(N2C(=O)c3c(Cl)ccc(NS(=O)c4ccc(C(C)(C)C)cc4)c3C2=O)c1 |
| InChI | InChI=1S/C24H22ClN3O3S/c1-14-11-12-26-19(13-14)28-22(29)20-17(25)9-10-18(21(20)23(28)30)27-32(31)16-7-5-15(6-8-16)24(2,3)4/h5-13,27H,1-4H3 |
| InChIKey | MHUCIRJJGMDUSU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|